Chú ý:Đây là bản xem thử online, xin hãy chọn download miễn phí bên dưới để xem bản đẹp dạng .pdf
-----------------------------  
ĐỀ ÔN TẬP HÓA HỌC – LN 2  
PHAN VĂN NAM  
Thời gian làm bài 50 phút (không kể thời gian phát đề)  
(Đề thi có 04 trang)  
-------------------------  
Mã đề thi: 002  
Cho biết nguyên tử khối của các nguyên tố: H=1; C=12; O=16; Na=23; K=39; Ag=108.  
Câu 1. Ở điều kiện thường, hợp chất hữu cơ nào sau đây ở trạng thái rắn?  
A. Metyl axetat.  
Câu 2. Cacbohiđrat nào sau đây không cho được phản ứng thủy phân?  
A. Glucozơ. B. Xenlulozơ. C. Saccarozơ.  
B. Triolein.  
C. Anđehit fomic.  
D. Tripanmitin.  
D. Amilozơ.  
Câu 3. Thuốc thử dùng để nhận biết hai dung dịch axit fomic và axit acrylic là  
A. quì tím.  
C. dung dịch AgNO3/NH3, đun nóng.  
B. dung dịch NaOH.  
D. dung dịch Br2.  
Câu 4. Thủy phân este nào sau đây trong dung dịch NaOH dư, đun nóng thu được hai muối?  
A. CH3OOC-CH2-COOC2H5.  
C. HCOOCH2-C6H5.  
B. CH3COOCH2-CH2-OOCCH3.  
D. HCOO-CH(CH3)-CH2-OOCCH3.  
Câu 5. Axit cacboxylic nào sau đây có mạch cacbon phân nhánh, làm mất màu dung dịch brom là  
A. axit 2-metylpropanoic.  
C. axit metacrylic.  
B. axit acrylic.  
D. axit propionic.  
Câu 6. Số đồng phân cấu tạo ancol bậc hai ứng với công thức phân tử C4H10O là  
A. 4  
B. 3.  
C. 2.  
D. 1.  
Câu 7. Isoamyl axetat có công thức cấu tạo thu gọn là  
A. CH3COOCH2-CH(CH3)2.  
B. CH3COOCH2-CH2-CH(CH3)2.  
C. CH3COOCH(CH3)-CH2-CH3.  
D. CH3COOCH(CH3)-CH2-CH2-CH3.  
Câu 8. Hợp chất hữu cơ nào sau đây cho được phản ứng thủy phân trong môi trường kiềm?  
A. tristearin. B. glucozơ. C. saccarozơ. D. xenlulozơ.  
Câu 9. Phản ứng nào sau đây là sai?  
0
Ni, t  
2   
3 3  
5 + 3H  0(C17H35COO) C H5.  
t
-CH= H  
A. (C17  
B. CH3COO  
H
33COO)3C3H  
C
H
2
CH2 + NaOH   CH3COONa + C -O-CH3.  
3
C. CH2OH[CHOH]4CHO + Br2 + H2O CH2OH[CHOH]4COOH + 2HBr.  
0
Ni, t  
D. OHC-CHO  
+
2H  
2
  C2  
H
4
(OH)2.  
0
Câu 10. Ancol nào sau đây khi đun nóng với H2SO4 đặc ở 170 C, thu được hỗn hợp gồm hai anken là  
đồng phân cấu tạo của nhau?  
A. propan-2-ol.  
B. 3-metylbutan-1-ol. C. butan-2-ol.  
D. 2-metypropan-2-ol.  
Câu 11. Đốt cháy hoàn toàn 11,1 gam este X, thu được 16,28 gam CO2  6,66 gam H2O. Công thức phân  
tử của X là  
A. C2H4O2.  
B. C3H4O2.  
C. C3H6O2.  
D. C4H6O2.  
Câu 12. Đun nóng 7,5 gam axit cacboxylic X với 6,21 gam ancol Y có mặt H2SO4 đặc làm xúc tác, thu  
được m gam etyl axetat. Hiệu suất phản ứng este hóa là 75%. Giá trị m là  
A. 11,88.  
B. 8,91.  
C. 11,00.  
D. 8,25.  
Câu 13. Hỗn hợp X gồm phenyl axetat và benzyl axetat có tỉ lệ mol 1 : 1. Lấy m gam X tác dụng với dung  
dịch NaOH dư, thu được 22,4 gam muối. Giá trị của m là  
A. 21,44.  
B. 26,08.  
C. 22,88.  
D. 24,68.  
Câu 14. Cho các axit có cùng nồng độ mol/1 gồm: axit axetic (1); axit propionic (2); axit fomic (3); axit  
butiric (4). Dãy gồm các axit có tính axit giảm dần từ trái qua phải là:  
A. (4),(2),(1),(3).  
B. (3),(4),(2),(1).  
C. (3),(2),(1),(4).  
D. (3),(1),(2),(4).  
Câu 15. Axit acrylic không có tính chất nào sau đây?  
A. Tồn tại đồng phân hình học.  
B. Tham gia phản ứng trùng hợp tạo polime.  
D. Làm mất màu dung dịch Br2.  
0
C. Tác dụng được với H2 (xúc tácNi, t ).  
Cậu 16. Dẫn m gam hỗn hợp X gồm axit axetic, axit acrylic và axit oxalic qua bình đựng Na dư, thu được  
,48 lít khí H2 (đktc). Nếu cho m gam X tác dụng vừa đủ với NaHCO3, thu được (1,25m + 3,22) gam  
4
muối. Giá trị của m là  
A. 20,48.  
B. 19,86.  
C. 24,04.  
D. 22,32.  
Trang 1/4-Mã đề 002  
Câu 17. Đun nóng 0,2 mol hỗn hợp gồm CH3COONH4  (COONH4)2 với dung dịch KOH vừa đủ, thu  
được 5,376 lít khí (đktc) và m gam muối. Giá trị m là  
A. 22,32.  
B. 18,48.  
C. 15,68.  
D. 26,64.  
Câu 18. X là hợp chất hữu cơ thuộc dãy đồng đẳng của axit acrylic. Đốt cháy hoàn toàn 0,2 mol X cần  
dùng 1,2 mol O2, thu được CO2  H2O. Số nguyên tử hiđro (H) có trong hợp chất hữu cơ X là  
A. 6.  
B. 8.  
C. 4.  
D. 10.  
Câu 19. Phát biểu nào sau đây là đúng?  
A. Trong phân tử của axit cacboxylic no, đơn chức, mạch hở chỉ chứa các liên kết đơn.  
B. Điều chế etyl axetat bằng cách đun sôi hỗn hợp gồm ancol etylic, axit axetic và axit sunfuric đặc  
trong cốc thủy tinh chịu nhiệt.  
C. Các anđehit no, mạch hở không có khả năng phản ứng cộng với H2 (xúc tác Ni, t0).  
D. Chất béo là hợp chất hữu cơ đa chức.  
Câu 20. Cho dãy các chất: etylen glicol, ancol anlylic, axetanđehit, metyl acrylat, glucozơ, triolein. Số  
chất trong dãy tác dụng với nước brom là  
A. 6.  
Câu 21. Điều khẳng định nào sau đây là sai?  
A. Ở điều kiện thường, ancol etylic tan vô hạn trong nước.  
B. 3.  
C. 4.  
D. 5.  
B.  điều kiện thường, glyxerol hòa tan được Cu(OH)2 tạo phức xanh lam.  
C. Oxi hóa không hoàn hoàn các ancol đơn chức bằng CuO đun nóng, đều thu được anđehit.  
D. Propan-2-ol là ancol bậc hai.  
Câu 22. Cho 16,44 gam hỗn hợp X gồm hai este đơn chức, mạch hở tác dụng vừa đủ với dung dịch  
NaOH, thu được natri axetat và 8,88 gam hỗn hợp Y gồm hai ancol. Dẫn toàn bộ Y qua bình đựng Na dư,  
thu được V lít khí H2 (đktc). Giá tr của Vlà  
A. 2,016.  
B. 5,376.  
C. 4,032.  
D. 2,688.  
Câu 23.  phòng hóa hoàn toàn 16,53 gam este X đơn chức, mạch hở với dung dịch KOH dư, thu được  
ancol Y và 17,98 gam muối. Số đồng phân cấu tạo của X thỏa mãn là  
A. 2.  
B. 3.  
C. 1.  
D. 4.  
Câu 24. Thc hiện sơ đồ phản ứng sau:  
X
  C2 OH   X. Mỗi mũi tên là một phản ứng trực  
H
5
tiếp. Trong các chất sau: axetilen, etyl axetat, axetanđehit, etilen và axit axetic. Số chất thỏa mãn chất X  
theo sơ đồ trên là  
A. 3.  
B. 4.  
C. 2.  
D. 5.  
Câu 25. Đun nóng a mol chất hữu cơ X mạch hở với dung dịch NaOH vừa đủ, chỉ thu được 2a mol muối  
Y (C3H3O2Na) và a mol ancol Z (C3H8O3). Phân tử khối của X là  
A. 254.  
B. 146.  
C. 200.  
D. 170.  
Câu 26. Dẫn 3,68 gam ancol X đơn chức qua ống sứ chứa CuO, đun nóng thu được hỗn hợp Y gồm các  
hợp chất hữu cơ; đồng thời khối lượng ống sứ giảm 1,28 gam. Lấy toàn bộ Y cho vào lượng dư dung dịch  
AgNO3 trong NH3, đun nóng thu được x gam Ag. Giá trị của x là  
A. 17,28.  
B. 34,56.  
C. 42,12.  
D. 21,06  
Câu 27. Đốt cháy hoàn toàn 0,005 mol ancol X, sản phẩm cháy gồm CO2  H2O được dẫn qua 1 lít dung  
dịch Ca(OH)2 0,01M thu được 0,5 gam kết tủa. Biết rằng, ở điều kiện thường, X hòa tan được Cu(OH)2  
tạo phức xanh lam. Số đồng phân cấu tạo thỏa mãn của X là  
A. 2.  
B. 4.  
C. 3.  
D. 1.  
0
Câu 28. Đun nóng m gam hỗn hợp X gồm hai ancol đều đơn chức, mạch hở với H2SO4 đặc ở 140 C, thu  
được hỗn hợp Y gồm ba ete có cùng số mol (trong đó có a mol ete Z) và 2,16 gam H2O. Đốt cháy hoàn  
toàn a mol Z, thu được 4,48 lít khí CO2 (đktc) và 3,6 gam H2O. Các phản ứng xảy ra hoàn toàn. Giá trị của  
m là  
A. 24,96.  
B. 33,28.  
C. 16,64.  
D. 12,48.  
Câu 29. X là hợp chất hữu cơ no, đơn chức, mạch hở có khả năng tác dụng với dung dịch NaOH loãng.  
Đốt cháy hoàn toàn X, thu được CO2 có số mol bằng số mol O2 đã phản ứng. Số chất thỏa mãn của X là  
A. 2.  
B. 3.  
C. 1.  
D. 4.  
Câu 30. Oxi hóa ancol X (C3H8O2) bằng CuO, đun nóng thu được chất hữu cơ Y đa chức. Nhận xét nào  
sau đây là đúng?  
A. X hòa tan được Cu(OH)2  điều kiệnthường.  
B. Trong X chứa hai nhóm –CH2.  
C. Lấy 1 mol Y tác dụng với lượng dư dung dịch AgNO3/NH3, thu được 2 mol Ag.  
D. Trong Y chứa một nhóm –CH2.  
Trang 2/4-Mã đề 002  
Câu 31. Cho các phát biểu sau:  
a) Phenyl axetat và metyl benzoat là đồng phân của nhau.  
b) Tinh bột là hỗn hợp của hai polisaccarit là amilozơ và amilopectin.  
(
(
(
(
c) Đisaccarit là nhóm cacbohiđrat không thể thủy phân được.  
d)  điều kiện thường, triolein ở trạng thái lỏng.  
Các phát biểu đúng là:  
A. (a),(b),(c).  
Câu 32. Thực hiện sơ đồ phản ứng sau (đúng với tỷ lệ mol các chất):  
B. (a),(b),(d).  
C. (b),(c),(d).  
D. (a),(c),(d).  
(2) X + O20   
2
Y + H O.  
xt, t  
0
0
H , t  
xt, t  
(
1) X + Y Z + H O.  
  
2
0
xt, t  
(
3) X   T +  
H
2
O.  
(4) T   polietilen.  
Nhận định nào sau đây là sai?  
A. Nhiệt độ sôi của X thấp hơn Y.  
B. Z có công thức phân tử C4H8O2.  
C. Z tác dụng với dung dịch AgNO3/NH3 tạo kết tủa bạctrắng.  
D. X và Y có cùng số nguyên tử cacbon.  
Câu 33. Hỗn hợp X gồm một anđehit no, đơn chức và một axit cacboxylic no, đơn chức, đều mạch hở.  
Cho 4,01 gam X tác dụng với lượng dư dung dịch AgNO3 trong NH3, đun nóng thu được 42,12 gam Ag và  
dung dịch Y chỉ chứa các hợp chất vô cơ. Phần trăm khối lượng của anđehit trong hỗn hợp X là  
A. 74,56%.  
B. 51,06%.  
C. 59,85%.  
D. 48,13%.  
Câu 34. Hiđro hóa hoàn toàn m gam hỗn hợp X gồm ba triaxylglyxerol cần dùng 0,32 mol H2 (xúc tác Ni,  
0
t ), thu được hỗn hợp Y. Đun nóng toàn bộ Y với dung dịch NaOH vừa đủ, thu được glyxerol có khối  
lượng là 18,4 gam và hỗn hợp Z gồm natri stearat (2a mol) và natri panmitat (a mol). Giá trị của m gần  
nhất với giá trị nào sau đây?  
A. 170.  
Câu 35. Cho các nhận định sau:  
a) Chất béo lỏng chứa chủ yếu các gốc axit béo không no.  
b) Một số este được dùng làm chất tạo hương trong công nghiệp mỹ phẩm, thực phẩm.  
c) Các este có nhiệt sôi thấp hơn các axit và ancol có cùng số nguyên tử cacbon.  
d) Metyl metacrylat có khả năng tham gia phản ứng trùng hợp tạo polime.  
e)  phòng hóa chất béo trong dung dịch NaOH, thu được xà phòng.  
B. 168.  
C. 174.  
D. 172.  
(
(
(
(
(
Số nhận định đúng là  
A. 5.  
B. 3.  
C. 2.  
D. 4.  
Câu 36. Thực hiện các thí nghiệm sau:  
a) Cho hơi ancol etylic qua bình đựng Na dư.  
b) Cho axetanđehit vào lượng dư dung dịch AgNO3 trong NH3, đunnóng.  
c) Cho dung dịch axit fomic vào dung dịch AgNO3 trong NH3, đunnóng.  
d) Sục khí axetilen vào dung dịch AgNO3 trongNH3.  
e) Nung nóng natri axetat với lượng dư vôi tôi xút.  
g) Cho dung dịch axetic vào lượng dư dung dịch NaHCO3.  
Sau khi kết thúc phản ứng, số thí nghiệm tạo ra đơn chất là  
A. 5. B. 4. C. 6.  
(
(
(
(
(
(
D. 3.  
Câu 37. Hỗn hợp X gồm một axit cacboxylic đơn chức và một ancol đơn chức, đều mạch hở. Đốt cháy  
hoàn toàn 18,72 gam X cần dùng 1,17 mol O2, thu được CO2  16,56 gam H2O. Mặt khác dẫn 18,72 gam  
X vào bình đựng Na dư, thấy khối lượng bình tăng 18,46 gam. Nếu đun nóng 18,72 gam X có mặt H2SO4  
đặc làm xúc tác, thu được 13,44 gam este Y. Hiệu suất phản ứng este hóa là  
A. 75,0%.  
B. 75,5%.  
C. 87,5%.  
D. 80,0%.  
Câu 38. Cho các phát biểu sau:  
(
(
(
(
(
a) Glucozơ còn gọi là đường nho.  
b) Trong công nghiệp, glucozơ được dùng tráng gương, tráng ruột phích.  
c) Trong y học, glucozơ được dùng làm thuốc tăng lực.  
d) Trong dung dịch, glucozơ tồn tại chủ yếu vòng 6 cạnh dạng   .  
e) Glucozơ thuộc nhóm cacbohiđrat đơn giản nhất.  
Số phát biểu đúng là  
A. 4.  
B. 2.  
C. 5.  
D. 3.  
Trang 3/4-Mã đề 002  
Câu 39. Đun nóng 0,2 mol hỗn hợp X gồm hai este đều đơn chức với dung dịch NaOH vừa đủ, thu được  
một ancol Y duy nhất và hỗn hợp Z gồm ba muối. Đốt cháy toàn bộ Z cần dùng 1,08 mol O2, thu được  
1
3,78 gam Na2CO3  1,38 mol hỗn hợp gồm CO2  H2O. Phần trăm khối lượng muối của axit  
cacboxylic có khối lượng phân tử lớn trong hỗn hợp Z là  
A. 57,8%. B. 51,4%. C. 50,3%.  
D. 58,9%.  
Câu 40. X, Y là hai hợp chất hữu cơ thuộc dãy đồng đẳng của axit acrylic; Z là ancol đa chức và T là este  
mạch hở; trong phân tử mỗi chất chỉ chứa một loại nhóm chức. Đun nóng 28,52 gam hỗn hợp E chứa X,  
Y, Z, T với dung dịch NaOH vừa đủ, thu được a gam một ancol Z duy nhất và hỗn hợp F gồm hai muối.  
Dẫn toàn bộ a gam Z qua bình đựng Na dư, thu được 4,48 lít khí H2 (đktc); đồng thời thấy khối lượng bình  
tăng 12,0 gam. Đốt cháy hoàn toàn F cần dùng 0,87 mol O2, thu được CO2, H2O và 14,84 gam Na2CO3.  
Tổng khối lượng của X và Y có trong 28,52 gam hỗn hợp E là  
A. 3,72.  
B. 4,40.  
C. 3,16.  
D. 8,12.  
-----------------------  
CHÚC CÁC EM LÀM BÀI TỐT  
Trang 4/4-Mã đề 002  
Có thể download miễn phí file .pdf bên dưới

ĐỀ ÔN HÓA HỌC LẦN 2

Đăng ngày 7/27/2017 7:59:09 PM | Thể loại: Hóa học 12 | Lần tải: 32 | Lần xem: 0 | Page: 4 | FileSize: 0.36 M | File type: pdf
0 lần xem

đề thi ĐỀ ÔN HÓA HỌC LẦN 2, Hóa học 12. . nslide.com trân trọng giới thiệu tới bạn đọc thư viện ĐỀ ÔN HÓA HỌC LẦN 2 .Để chia sẽ thêm cho bạn đọc nguồn tài liệu tham khảo phục vụ cho công tác giảng dạy, học tập và nghiên cứu khoa học, trân trọng kính mời đọc giả quan tâm cùng xem , Tài liệu ĐỀ ÔN HÓA HỌC LẦN 2 trong chuyên mục Hóa học 12 được chia sẽ bởi user Nam Phan Văn tới cộng đồng nhằm mục tiêu nâng cao kiến thức , tài liệu này được chia sẽ vào mục Hóa học 12 , có 4 page, thuộc file .pdf, cùng thể loại còn có Đề thi Hóa học Hóa học 12 ,bạn có thể tải về miễn phí , hãy chia sẽ cho mọi người cùng học tập

https://nslide.com/de-thi/de-on-hoa-hoc-lan-2.xezu0q.html